About [4-(bromomethyl)phenyl] thiohypochlorite
[4-(bromomethyl)phenyl] thiohypochlorite (PubChem CID 19023327) has the molecular formula C7H6BrClS
and a molecular weight of 237.55 g/mol. Its IUPAC name is [4-(bromomethyl)phenyl] thiohypochlorite.
Molecular Properties
| Compound Name | [4-(bromomethyl)phenyl] thiohypochlorite |
| PubChem CID | 19023327 |
| Molecular Formula | C7H6BrClS |
| Molecular Weight | 237.55 g/mol |
| Exact Mass | 235.91 |
| IUPAC Name | [4-(bromomethyl)phenyl] thiohypochlorite |
| SMILES | ClSc1ccc(CBr)cc1 |
| InChI | InChI=1S/C7H6BrClS/c8-5-6-1-3-7(10-9)4-2-6/h1-4H,5H2 |
| InChIKey | OAVDHZQCFNAVLQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [4-(bromomethyl)phenyl] thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(bromomethyl)phenyl] thiohypochlorite?
The IUPAC name of [4-(bromomethyl)phenyl] thiohypochlorite (CID 19023327) is [4-(bromomethyl)phenyl] thiohypochlorite.
What is the SMILES notation for [4-(bromomethyl)phenyl] thiohypochlorite?
The canonical SMILES for [4-(bromomethyl)phenyl] thiohypochlorite is ClSc1ccc(CBr)cc1.
What is the InChIKey of [4-(bromomethyl)phenyl] thiohypochlorite?
The InChIKey is OAVDHZQCFNAVLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrClS/c8-5-6-1-3-7(10-9)4-2-6/h1-4H,5H2.
What are the key properties of [4-(bromomethyl)phenyl] thiohypochlorite?
[4-(bromomethyl)phenyl] thiohypochlorite has a molecular weight of 237.55 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(bromomethyl)phenyl] thiohypochlorite is sourced from PubChem (CID 19023327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).