About palladium;bis(tripropylphosphanium)
palladium;bis(tripropylphosphanium) (PubChem CID 87652047) has the molecular formula C18H44P2Pd+2
and a molecular weight of 428.92 g/mol. Its IUPAC name is palladium;bis(tripropylphosphanium).
Molecular Properties
| Compound Name | palladium;bis(tripropylphosphanium) |
| PubChem CID | 87652047 |
| Molecular Formula | C18H44P2Pd+2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | palladium;bis(tripropylphosphanium) |
| SMILES | CCC[PH+](CCC)CCC.CCC[PH+](CCC)CCC.[Pd] |
| InChI | InChI=1S/2C9H21P.Pd/c2*1-4-7-10(8-5-2)9-6-3;/h2*4-9H2,1-3H3;/p+2 |
| InChIKey | YDNQSYDHKKSVAQ-UHFFFAOYSA-P |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze palladium;bis(tripropylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;bis(tripropylphosphanium)?
The IUPAC name of palladium;bis(tripropylphosphanium) (CID 87652047) is palladium;bis(tripropylphosphanium).
What is the SMILES notation for palladium;bis(tripropylphosphanium)?
The canonical SMILES for palladium;bis(tripropylphosphanium) is CCC[PH+](CCC)CCC.CCC[PH+](CCC)CCC.[Pd].
What is the InChIKey of palladium;bis(tripropylphosphanium)?
The InChIKey is YDNQSYDHKKSVAQ-UHFFFAOYSA-P. The full InChI is InChI=1S/2C9H21P.Pd/c2*1-4-7-10(8-5-2)9-6-3;/h2*4-9H2,1-3H3;/p+2.
What are the key properties of palladium;bis(tripropylphosphanium)?
palladium;bis(tripropylphosphanium) has a molecular weight of 428.92 g/mol, XLogP of 6.86, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;bis(tripropylphosphanium) is sourced from PubChem (CID 87652047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).