About 1,1-dichlorohex-2-yne
1,1-dichlorohex-2-yne (PubChem CID 15164826) has the molecular formula C6H8Cl2
and a molecular weight of 151.04 g/mol. Its IUPAC name is 1,1-dichlorohex-2-yne.
Molecular Properties
| Compound Name | 1,1-dichlorohex-2-yne |
| PubChem CID | 15164826 |
| Molecular Formula | C6H8Cl2 |
| Molecular Weight | 151.04 g/mol |
| Exact Mass | 150.00 |
| IUPAC Name | 1,1-dichlorohex-2-yne |
| SMILES | CCCC#CC(Cl)Cl |
| InChI | InChI=1S/C6H8Cl2/c1-2-3-4-5-6(7)8/h6H,2-3H2,1H3 |
| InChIKey | IXSXNGZUUNDSSB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.04 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichlorohex-2-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichlorohex-2-yne?
The IUPAC name of 1,1-dichlorohex-2-yne (CID 15164826) is 1,1-dichlorohex-2-yne.
What is the SMILES notation for 1,1-dichlorohex-2-yne?
The canonical SMILES for 1,1-dichlorohex-2-yne is CCCC#CC(Cl)Cl.
What is the InChIKey of 1,1-dichlorohex-2-yne?
The InChIKey is IXSXNGZUUNDSSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Cl2/c1-2-3-4-5-6(7)8/h6H,2-3H2,1H3.
What are the key properties of 1,1-dichlorohex-2-yne?
1,1-dichlorohex-2-yne has a molecular weight of 151.04 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichlorohex-2-yne is sourced from PubChem (CID 15164826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).