About undeca-4,7-diyn-6-ol
undeca-4,7-diyn-6-ol (PubChem CID 15932781) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is undeca-4,7-diyn-6-ol.
Molecular Properties
| Compound Name | undeca-4,7-diyn-6-ol |
| PubChem CID | 15932781 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | undeca-4,7-diyn-6-ol |
| SMILES | CCCC#CC(O)C#CCCC |
| InChI | InChI=1S/C11H16O/c1-3-5-7-9-11(12)10-8-6-4-2/h11-12H,3-6H2,1-2H3 |
| InChIKey | ANQPLDHZQVCDOY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze undeca-4,7-diyn-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undeca-4,7-diyn-6-ol?
The IUPAC name of undeca-4,7-diyn-6-ol (CID 15932781) is undeca-4,7-diyn-6-ol.
What is the SMILES notation for undeca-4,7-diyn-6-ol?
The canonical SMILES for undeca-4,7-diyn-6-ol is CCCC#CC(O)C#CCCC.
What is the InChIKey of undeca-4,7-diyn-6-ol?
The InChIKey is ANQPLDHZQVCDOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O/c1-3-5-7-9-11(12)10-8-6-4-2/h11-12H,3-6H2,1-2H3.
What are the key properties of undeca-4,7-diyn-6-ol?
undeca-4,7-diyn-6-ol has a molecular weight of 164.25 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for undeca-4,7-diyn-6-ol is sourced from PubChem (CID 15932781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).