C15H24O — CID 140765594
2,12-dimethyltrideca-5,8-diyn-7-ol (PubChem CID 140765594) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 2,12-dimethyltrideca-5,8-diyn-7-ol.
| Compound Name | 2,12-dimethyltrideca-5,8-diyn-7-ol |
|---|---|
| PubChem CID | 140765594 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2,12-dimethyltrideca-5,8-diyn-7-ol |
| SMILES | CC(C)CCC#CC(O)C#CCCC(C)C |
| InChI | InChI=1S/C15H24O/c1-13(2)9-5-7-11-15(16)12-8-6-10-14(3)4/h13-16H,5-6,9-10H2,1-4H3 |
| InChIKey | OJGYJANMNORIER-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|