About 2,12-dimethyltrideca-5,8-diyn-7-ol
2,12-dimethyltrideca-5,8-diyn-7-ol (PubChem CID 140765594) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is 2,12-dimethyltrideca-5,8-diyn-7-ol.
Molecular Properties
| Compound Name | 2,12-dimethyltrideca-5,8-diyn-7-ol |
| PubChem CID | 140765594 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2,12-dimethyltrideca-5,8-diyn-7-ol |
| SMILES | CC(C)CCC#CC(O)C#CCCC(C)C |
| InChI | InChI=1S/C15H24O/c1-13(2)9-5-7-11-15(16)12-8-6-10-14(3)4/h13-16H,5-6,9-10H2,1-4H3 |
| InChIKey | OJGYJANMNORIER-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,12-dimethyltrideca-5,8-diyn-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,12-dimethyltrideca-5,8-diyn-7-ol?
The IUPAC name of 2,12-dimethyltrideca-5,8-diyn-7-ol (CID 140765594) is 2,12-dimethyltrideca-5,8-diyn-7-ol.
What is the SMILES notation for 2,12-dimethyltrideca-5,8-diyn-7-ol?
The canonical SMILES for 2,12-dimethyltrideca-5,8-diyn-7-ol is CC(C)CCC#CC(O)C#CCCC(C)C.
What is the InChIKey of 2,12-dimethyltrideca-5,8-diyn-7-ol?
The InChIKey is OJGYJANMNORIER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O/c1-13(2)9-5-7-11-15(16)12-8-6-10-14(3)4/h13-16H,5-6,9-10H2,1-4H3.
What are the key properties of 2,12-dimethyltrideca-5,8-diyn-7-ol?
2,12-dimethyltrideca-5,8-diyn-7-ol has a molecular weight of 220.36 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,12-dimethyltrideca-5,8-diyn-7-ol is sourced from PubChem (CID 140765594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).