C20H26O2 — CID 138980307
(3S,18R)-icosa-1,4,16,19-tetrayne-3,18-diol (PubChem CID 138980307) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (3S,18R)-icosa-1,4,16,19-tetrayne-3,18-diol.
| Compound Name | (3S,18R)-icosa-1,4,16,19-tetrayne-3,18-diol |
|---|---|
| PubChem CID | 138980307 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (3S,18R)-icosa-1,4,16,19-tetrayne-3,18-diol |
| SMILES | C#C[C@@H](O)C#CCCCCCCCCCCC#C[C@@H](O)C#C |
| InChI | InChI=1S/C20H26O2/c1-3-19(21)17-15-13-11-9-7-5-6-8-10-12-14-16-18-20(22)4-2/h1-2,19-22H,5-14H2/t19-,20+ |
| InChIKey | KCLFZCABXKEIPV-BGYRXZFFSA-N |
| XLogP | 2.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|