C19H28O — CID 138979996
nonadeca-1,4,6-triyn-3-ol (PubChem CID 138979996) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is nonadeca-1,4,6-triyn-3-ol.
| Compound Name | nonadeca-1,4,6-triyn-3-ol |
|---|---|
| PubChem CID | 138979996 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | nonadeca-1,4,6-triyn-3-ol |
| SMILES | C#CC(O)C#CC#CCCCCCCCCCCCC |
| InChI | InChI=1S/C19H28O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)4-2/h2,19-20H,3,5-14H2,1H3 |
| InChIKey | LOKGUAKRMXAIPQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|