C17H28O2 — CID 175955056
heptadeca-4,6-diyne-1,8-diol (PubChem CID 175955056) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is heptadeca-4,6-diyne-1,8-diol.
| Compound Name | heptadeca-4,6-diyne-1,8-diol |
|---|---|
| PubChem CID | 175955056 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | heptadeca-4,6-diyne-1,8-diol |
| SMILES | CCCCCCCCCC(O)C#CC#CCCCO |
| InChI | InChI=1S/C17H28O2/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18/h17-19H,2-6,8,10-11,13-14,16H2,1H3 |
| InChIKey | VCPMIOZCPHKNKY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|