C17H26O — CID 162872076
heptadec-16-en-4,6-diyn-8-ol (PubChem CID 162872076) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is heptadec-16-en-4,6-diyn-8-ol.
| Compound Name | heptadec-16-en-4,6-diyn-8-ol |
|---|---|
| PubChem CID | 162872076 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | heptadec-16-en-4,6-diyn-8-ol |
| SMILES | C=CCCCCCCCC(O)C#CC#CCCC |
| InChI | InChI=1S/C17H26O/c1-3-5-7-9-10-12-14-16-17(18)15-13-11-8-6-4-2/h3,17-18H,1,4-7,9-10,12,14,16H2,2H3 |
| InChIKey | AYXCDALAXNSBPZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|