C31H56O2Si — CID 11179314
(Z,6R)-1-[tert-butyl(dimethyl)silyl]oxypentacos-16-en-2,4-diyn-6-ol (PubChem CID 11179314) has the molecular formula C31H56O2Si and a molecular weight of 488.87 g/mol. Its IUPAC name is (Z,6R)-1-[tert-butyl(dimethyl)silyl]oxypentacos-16-en-2,4-diyn-6-ol.
| Compound Name | (Z,6R)-1-[tert-butyl(dimethyl)silyl]oxypentacos-16-en-2,4-diyn-6-ol |
|---|---|
| PubChem CID | 11179314 |
| Molecular Formula | C31H56O2Si |
| Molecular Weight | 488.87 g/mol |
| Exact Mass | 488.40 |
| IUPAC Name | (Z,6R)-1-[tert-butyl(dimethyl)silyl]oxypentacos-16-en-2,4-diyn-6-ol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC[C@@H](O)C#CC#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H56O2Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-27-30(32)28-25-23-26-29-33-34(5,6)31(2,3)4/h14-15,30,32H,7-13,16-22,24,27,29H2,1-6H3/b15-14-/t30-/m1/s1 |
| InChIKey | DUZBAKFQEJQOHI-QKLXQQGTSA-N |
| XLogP | 9.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.87 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|