C24H38O — CID 53475583
(3R)-2-methyltricosa-4,6,8-triyn-3-ol (PubChem CID 53475583) has the molecular formula C24H38O and a molecular weight of 342.57 g/mol. Its IUPAC name is (3R)-2-methyltricosa-4,6,8-triyn-3-ol.
| Compound Name | (3R)-2-methyltricosa-4,6,8-triyn-3-ol |
|---|---|
| PubChem CID | 53475583 |
| Molecular Formula | C24H38O |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | (3R)-2-methyltricosa-4,6,8-triyn-3-ol |
| SMILES | CCCCCCCCCCCCCCC#CC#CC#C[C@H](O)C(C)C |
| InChI | InChI=1S/C24H38O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(25)23(2)3/h23-25H,4-16H2,1-3H3/t24-/m0/s1 |
| InChIKey | NNIODLFTRULDPU-DEOSSOPVSA-N |
| XLogP | 6.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|