About 2-methyldeca-3,5-diyne
2-methyldeca-3,5-diyne (PubChem CID 10510996) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is 2-methyldeca-3,5-diyne.
Molecular Properties
| Compound Name | 2-methyldeca-3,5-diyne |
| PubChem CID | 10510996 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 2-methyldeca-3,5-diyne |
| SMILES | CCCCC#CC#CC(C)C |
| InChI | InChI=1S/C11H16/c1-4-5-6-7-8-9-10-11(2)3/h11H,4-6H2,1-3H3 |
| InChIKey | QLSVSKOSRXVTMZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyldeca-3,5-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyldeca-3,5-diyne?
The IUPAC name of 2-methyldeca-3,5-diyne (CID 10510996) is 2-methyldeca-3,5-diyne.
What is the SMILES notation for 2-methyldeca-3,5-diyne?
The canonical SMILES for 2-methyldeca-3,5-diyne is CCCCC#CC#CC(C)C.
What is the InChIKey of 2-methyldeca-3,5-diyne?
The InChIKey is QLSVSKOSRXVTMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16/c1-4-5-6-7-8-9-10-11(2)3/h11H,4-6H2,1-3H3.
What are the key properties of 2-methyldeca-3,5-diyne?
2-methyldeca-3,5-diyne has a molecular weight of 148.25 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyldeca-3,5-diyne is sourced from PubChem (CID 10510996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).