C16H30O3 — CID 177314687
hexadec-12-yne-1,11,14-triol (PubChem CID 177314687) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is hexadec-12-yne-1,11,14-triol.
| Compound Name | hexadec-12-yne-1,11,14-triol |
|---|---|
| PubChem CID | 177314687 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | hexadec-12-yne-1,11,14-triol |
| SMILES | CCC(O)C#CC(O)CCCCCCCCCCO |
| InChI | InChI=1S/C16H30O3/c1-2-15(18)12-13-16(19)11-9-7-5-3-4-6-8-10-14-17/h15-19H,2-11,14H2,1H3 |
| InChIKey | HIBLFYMZEKRVHA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|