About 16-aminohexadec-4-yne-3,6-diol
16-aminohexadec-4-yne-3,6-diol (PubChem CID 177314650) has the molecular formula C16H31NO2
and a molecular weight of 269.43 g/mol. Its IUPAC name is 16-aminohexadec-4-yne-3,6-diol.
Molecular Properties
| Compound Name | 16-aminohexadec-4-yne-3,6-diol |
| PubChem CID | 177314650 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 16-aminohexadec-4-yne-3,6-diol |
| SMILES | CCC(O)C#CC(O)CCCCCCCCCCN |
| InChI | InChI=1S/C16H31NO2/c1-2-15(18)12-13-16(19)11-9-7-5-3-4-6-8-10-14-17/h15-16,18-19H,2-11,14,17H2,1H3 |
| InChIKey | ITNAFTVNHFETOJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 16-aminohexadec-4-yne-3,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 16-aminohexadec-4-yne-3,6-diol?
The IUPAC name of 16-aminohexadec-4-yne-3,6-diol (CID 177314650) is 16-aminohexadec-4-yne-3,6-diol.
What is the SMILES notation for 16-aminohexadec-4-yne-3,6-diol?
The canonical SMILES for 16-aminohexadec-4-yne-3,6-diol is CCC(O)C#CC(O)CCCCCCCCCCN.
What is the InChIKey of 16-aminohexadec-4-yne-3,6-diol?
The InChIKey is ITNAFTVNHFETOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO2/c1-2-15(18)12-13-16(19)11-9-7-5-3-4-6-8-10-14-17/h15-16,18-19H,2-11,14,17H2,1H3.
What are the key properties of 16-aminohexadec-4-yne-3,6-diol?
16-aminohexadec-4-yne-3,6-diol has a molecular weight of 269.43 g/mol, XLogP of 2.59, 11 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 16-aminohexadec-4-yne-3,6-diol is sourced from PubChem (CID 177314650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).