About dec-3-yne-2,5-diol
dec-3-yne-2,5-diol (PubChem CID 154189679) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is dec-3-yne-2,5-diol.
Molecular Properties
| Compound Name | dec-3-yne-2,5-diol |
| PubChem CID | 154189679 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | dec-3-yne-2,5-diol |
| SMILES | CCCCCC(O)C#CC(C)O |
| InChI | InChI=1S/C10H18O2/c1-3-4-5-6-10(12)8-7-9(2)11/h9-12H,3-6H2,1-2H3 |
| InChIKey | GQYLRBVRXXXXJR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dec-3-yne-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-3-yne-2,5-diol?
The IUPAC name of dec-3-yne-2,5-diol (CID 154189679) is dec-3-yne-2,5-diol.
What is the SMILES notation for dec-3-yne-2,5-diol?
The canonical SMILES for dec-3-yne-2,5-diol is CCCCCC(O)C#CC(C)O.
What is the InChIKey of dec-3-yne-2,5-diol?
The InChIKey is GQYLRBVRXXXXJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-3-4-5-6-10(12)8-7-9(2)11/h9-12H,3-6H2,1-2H3.
What are the key properties of dec-3-yne-2,5-diol?
dec-3-yne-2,5-diol has a molecular weight of 170.25 g/mol, XLogP of 1.31, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dec-3-yne-2,5-diol is sourced from PubChem (CID 154189679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).