About 5-methylhex-1-ynyl 2-hydroxypropanoate
5-methylhex-1-ynyl 2-hydroxypropanoate (PubChem CID 140532504) has the molecular formula C10H16O3
and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-methylhex-1-ynyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | 5-methylhex-1-ynyl 2-hydroxypropanoate |
| PubChem CID | 140532504 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 5-methylhex-1-ynyl 2-hydroxypropanoate |
| SMILES | CC(C)CCC#COC(=O)C(C)O |
| InChI | InChI=1S/C10H16O3/c1-8(2)6-4-5-7-13-10(12)9(3)11/h8-9,11H,4,6H2,1-3H3 |
| InChIKey | DZMLBYKWZKXZDC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhex-1-ynyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhex-1-ynyl 2-hydroxypropanoate?
The IUPAC name of 5-methylhex-1-ynyl 2-hydroxypropanoate (CID 140532504) is 5-methylhex-1-ynyl 2-hydroxypropanoate.
What is the SMILES notation for 5-methylhex-1-ynyl 2-hydroxypropanoate?
The canonical SMILES for 5-methylhex-1-ynyl 2-hydroxypropanoate is CC(C)CCC#COC(=O)C(C)O.
What is the InChIKey of 5-methylhex-1-ynyl 2-hydroxypropanoate?
The InChIKey is DZMLBYKWZKXZDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-8(2)6-4-5-7-13-10(12)9(3)11/h8-9,11H,4,6H2,1-3H3.
What are the key properties of 5-methylhex-1-ynyl 2-hydroxypropanoate?
5-methylhex-1-ynyl 2-hydroxypropanoate has a molecular weight of 184.24 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhex-1-ynyl 2-hydroxypropanoate is sourced from PubChem (CID 140532504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).