About 6-methylhept-1-ynyl 2-hydroxypropanoate
6-methylhept-1-ynyl 2-hydroxypropanoate (PubChem CID 140532508) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is 6-methylhept-1-ynyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | 6-methylhept-1-ynyl 2-hydroxypropanoate |
| PubChem CID | 140532508 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 6-methylhept-1-ynyl 2-hydroxypropanoate |
| SMILES | CC(C)CCCC#COC(=O)C(C)O |
| InChI | InChI=1S/C11H18O3/c1-9(2)7-5-4-6-8-14-11(13)10(3)12/h9-10,12H,4-5,7H2,1-3H3 |
| InChIKey | ZOUATTSMEYRMQS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methylhept-1-ynyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylhept-1-ynyl 2-hydroxypropanoate?
The IUPAC name of 6-methylhept-1-ynyl 2-hydroxypropanoate (CID 140532508) is 6-methylhept-1-ynyl 2-hydroxypropanoate.
What is the SMILES notation for 6-methylhept-1-ynyl 2-hydroxypropanoate?
The canonical SMILES for 6-methylhept-1-ynyl 2-hydroxypropanoate is CC(C)CCCC#COC(=O)C(C)O.
What is the InChIKey of 6-methylhept-1-ynyl 2-hydroxypropanoate?
The InChIKey is ZOUATTSMEYRMQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-9(2)7-5-4-6-8-14-11(13)10(3)12/h9-10,12H,4-5,7H2,1-3H3.
What are the key properties of 6-methylhept-1-ynyl 2-hydroxypropanoate?
6-methylhept-1-ynyl 2-hydroxypropanoate has a molecular weight of 198.26 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylhept-1-ynyl 2-hydroxypropanoate is sourced from PubChem (CID 140532508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).