About 4-methylpent-1-ynyl 2-hydroxypropanoate
4-methylpent-1-ynyl 2-hydroxypropanoate (PubChem CID 140532502) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 4-methylpent-1-ynyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | 4-methylpent-1-ynyl 2-hydroxypropanoate |
| PubChem CID | 140532502 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 4-methylpent-1-ynyl 2-hydroxypropanoate |
| SMILES | CC(C)CC#COC(=O)C(C)O |
| InChI | InChI=1S/C9H14O3/c1-7(2)5-4-6-12-9(11)8(3)10/h7-8,10H,5H2,1-3H3 |
| InChIKey | RFTKSIWOIWDPAO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpent-1-ynyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpent-1-ynyl 2-hydroxypropanoate?
The IUPAC name of 4-methylpent-1-ynyl 2-hydroxypropanoate (CID 140532502) is 4-methylpent-1-ynyl 2-hydroxypropanoate.
What is the SMILES notation for 4-methylpent-1-ynyl 2-hydroxypropanoate?
The canonical SMILES for 4-methylpent-1-ynyl 2-hydroxypropanoate is CC(C)CC#COC(=O)C(C)O.
What is the InChIKey of 4-methylpent-1-ynyl 2-hydroxypropanoate?
The InChIKey is RFTKSIWOIWDPAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-7(2)5-4-6-12-9(11)8(3)10/h7-8,10H,5H2,1-3H3.
What are the key properties of 4-methylpent-1-ynyl 2-hydroxypropanoate?
4-methylpent-1-ynyl 2-hydroxypropanoate has a molecular weight of 170.21 g/mol, XLogP of 0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpent-1-ynyl 2-hydroxypropanoate is sourced from PubChem (CID 140532502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).