About 3-methylbutyl 2-hydroxypropaneperoxoate
3-methylbutyl 2-hydroxypropaneperoxoate (PubChem CID 91454060) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is 3-methylbutyl 2-hydroxypropaneperoxoate.
Molecular Properties
| Compound Name | 3-methylbutyl 2-hydroxypropaneperoxoate |
| PubChem CID | 91454060 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 3-methylbutyl 2-hydroxypropaneperoxoate |
| SMILES | CC(C)CCOOC(=O)C(C)O |
| InChI | InChI=1S/C8H16O4/c1-6(2)4-5-11-12-8(10)7(3)9/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | BDKHWFMATGFLRW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutyl 2-hydroxypropaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl 2-hydroxypropaneperoxoate?
The IUPAC name of 3-methylbutyl 2-hydroxypropaneperoxoate (CID 91454060) is 3-methylbutyl 2-hydroxypropaneperoxoate.
What is the SMILES notation for 3-methylbutyl 2-hydroxypropaneperoxoate?
The canonical SMILES for 3-methylbutyl 2-hydroxypropaneperoxoate is CC(C)CCOOC(=O)C(C)O.
What is the InChIKey of 3-methylbutyl 2-hydroxypropaneperoxoate?
The InChIKey is BDKHWFMATGFLRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4/c1-6(2)4-5-11-12-8(10)7(3)9/h6-7,9H,4-5H2,1-3H3.
What are the key properties of 3-methylbutyl 2-hydroxypropaneperoxoate?
3-methylbutyl 2-hydroxypropaneperoxoate has a molecular weight of 176.21 g/mol, XLogP of 0.89, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl 2-hydroxypropaneperoxoate is sourced from PubChem (CID 91454060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).