About 1-iodo-5-methylhex-1-yne
1-iodo-5-methylhex-1-yne (PubChem CID 14941760) has the molecular formula C7H11I
and a molecular weight of 222.07 g/mol. Its IUPAC name is 1-iodo-5-methylhex-1-yne.
Molecular Properties
| Compound Name | 1-iodo-5-methylhex-1-yne |
| PubChem CID | 14941760 |
| Molecular Formula | C7H11I |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 1-iodo-5-methylhex-1-yne |
| SMILES | CC(C)CCC#CI |
| InChI | InChI=1S/C7H11I/c1-7(2)5-3-4-6-8/h7H,3,5H2,1-2H3 |
| InChIKey | NSDALFVVQFXLNJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-5-methylhex-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-5-methylhex-1-yne?
The IUPAC name of 1-iodo-5-methylhex-1-yne (CID 14941760) is 1-iodo-5-methylhex-1-yne.
What is the SMILES notation for 1-iodo-5-methylhex-1-yne?
The canonical SMILES for 1-iodo-5-methylhex-1-yne is CC(C)CCC#CI.
What is the InChIKey of 1-iodo-5-methylhex-1-yne?
The InChIKey is NSDALFVVQFXLNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11I/c1-7(2)5-3-4-6-8/h7H,3,5H2,1-2H3.
What are the key properties of 1-iodo-5-methylhex-1-yne?
1-iodo-5-methylhex-1-yne has a molecular weight of 222.07 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-5-methylhex-1-yne is sourced from PubChem (CID 14941760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).