C19H44 — CID 158252913
2,5-dimethylhexane;2,4-dimethylpentane;2-methylpropane (PubChem CID 158252913) has the molecular formula C19H44 and a molecular weight of 272.56 g/mol. Its IUPAC name is 2,5-dimethylhexane;2,4-dimethylpentane;2-methylpropane.
| Compound Name | 2,5-dimethylhexane;2,4-dimethylpentane;2-methylpropane |
|---|---|
| PubChem CID | 158252913 |
| Molecular Formula | C19H44 |
| Molecular Weight | 272.56 g/mol |
| Exact Mass | 272.34 |
| IUPAC Name | 2,5-dimethylhexane;2,4-dimethylpentane;2-methylpropane |
| SMILES | CC(C)C.CC(C)CC(C)C.CC(C)CCC(C)C |
| InChI | InChI=1S/C8H18.C7H16.C4H10/c1-7(2)5-6-8(3)4;1-6(2)5-7(3)4;1-4(2)3/h7-8H,5-6H2,1-4H3;6-7H,5H2,1-4H3;4H,1-3H3 |
| InChIKey | GGXXNMQTAFYJIE-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.56 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |