About acetylene;2,4-dimethylpentane
acetylene;2,4-dimethylpentane (PubChem CID 167651238) has the molecular formula C9H18
and a molecular weight of 126.24 g/mol. Its IUPAC name is acetylene;2,4-dimethylpentane.
Molecular Properties
| Compound Name | acetylene;2,4-dimethylpentane |
| PubChem CID | 167651238 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | acetylene;2,4-dimethylpentane |
| SMILES | C#C.CC(C)CC(C)C |
| InChI | InChI=1S/C7H16.C2H2/c1-6(2)5-7(3)4;1-2/h6-7H,5H2,1-4H3;1-2H |
| InChIKey | QPPOHOGHRNTMGK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;2,4-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;2,4-dimethylpentane?
The IUPAC name of acetylene;2,4-dimethylpentane (CID 167651238) is acetylene;2,4-dimethylpentane.
What is the SMILES notation for acetylene;2,4-dimethylpentane?
The canonical SMILES for acetylene;2,4-dimethylpentane is C#C.CC(C)CC(C)C.
What is the InChIKey of acetylene;2,4-dimethylpentane?
The InChIKey is QPPOHOGHRNTMGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C2H2/c1-6(2)5-7(3)4;1-2/h6-7H,5H2,1-4H3;1-2H.
What are the key properties of acetylene;2,4-dimethylpentane?
acetylene;2,4-dimethylpentane has a molecular weight of 126.24 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;2,4-dimethylpentane is sourced from PubChem (CID 167651238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).