C9H20S — CID 56980634
2,3,5-trimethylhexane-1-thiol (PubChem CID 56980634) has the molecular formula C9H20S and a molecular weight of 160.33 g/mol. Its IUPAC name is 2,3,5-trimethylhexane-1-thiol.
| Compound Name | 2,3,5-trimethylhexane-1-thiol |
|---|---|
| PubChem CID | 56980634 |
| Molecular Formula | C9H20S |
| Molecular Weight | 160.33 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 2,3,5-trimethylhexane-1-thiol |
| SMILES | CC(C)CC(C)C(C)CS |
| InChI | InChI=1S/C9H20S/c1-7(2)5-8(3)9(4)6-10/h7-10H,5-6H2,1-4H3 |
| InChIKey | ZKNMUYCRVHQZIE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|