C9H19Cl — CID 130519679
1-chloro-2,3,5-trimethylhexane (PubChem CID 130519679) has the molecular formula C9H19Cl and a molecular weight of 162.70 g/mol. Its IUPAC name is 1-chloro-2,3,5-trimethylhexane.
| Compound Name | 1-chloro-2,3,5-trimethylhexane |
|---|---|
| PubChem CID | 130519679 |
| Molecular Formula | C9H19Cl |
| Molecular Weight | 162.70 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1-chloro-2,3,5-trimethylhexane |
| SMILES | CC(C)CC(C)C(C)CCl |
| InChI | InChI=1S/C9H19Cl/c1-7(2)5-8(3)9(4)6-10/h7-9H,5-6H2,1-4H3 |
| InChIKey | MNTNTSXYHIRYEL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.70 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|