C4H7Cl3 — CID 23268512
1,1,3-trichloro-2-methylpropane (PubChem CID 23268512) has the molecular formula C4H7Cl3 and a molecular weight of 161.46 g/mol. Its IUPAC name is 1,1,3-trichloro-2-methylpropane.
| Compound Name | 1,1,3-trichloro-2-methylpropane |
|---|---|
| PubChem CID | 23268512 |
| Molecular Formula | C4H7Cl3 |
| Molecular Weight | 161.46 g/mol |
| Exact Mass | 159.96 |
| IUPAC Name | 1,1,3-trichloro-2-methylpropane |
| SMILES | CC(CCl)C(Cl)Cl |
| InChI | InChI=1S/C4H7Cl3/c1-3(2-5)4(6)7/h3-4H,2H2,1H3 |
| InChIKey | DVWVZCHMYCZESE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|