About 2-bromo-1-chloropropane
2-bromo-1-chloropropane (PubChem CID 18175) has the molecular formula C3H6BrCl
and a molecular weight of 157.44 g/mol. Its IUPAC name is 2-bromo-1-chloropropane.
Molecular Properties
| Compound Name | 2-bromo-1-chloropropane |
| PubChem CID | 18175 |
| Molecular Formula | C3H6BrCl |
| Molecular Weight | 157.44 g/mol |
| Exact Mass | 155.93 |
| IUPAC Name | 2-bromo-1-chloropropane |
| SMILES | CC(Br)CCl |
| InChI | InChI=1S/C3H6BrCl/c1-3(4)2-5/h3H,2H2,1H3 |
| InChIKey | PUJJZGFFAQHYEX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-chloropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-chloropropane?
The IUPAC name of 2-bromo-1-chloropropane (CID 18175) is 2-bromo-1-chloropropane.
What is the SMILES notation for 2-bromo-1-chloropropane?
The canonical SMILES for 2-bromo-1-chloropropane is CC(Br)CCl.
What is the InChIKey of 2-bromo-1-chloropropane?
The InChIKey is PUJJZGFFAQHYEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6BrCl/c1-3(4)2-5/h3H,2H2,1H3.
What are the key properties of 2-bromo-1-chloropropane?
2-bromo-1-chloropropane has a molecular weight of 157.44 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-chloropropane is sourced from PubChem (CID 18175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).