About 1,2-dichloropropane;titanium
1,2-dichloropropane;titanium (PubChem CID 88762967) has the molecular formula C3H6Cl2Ti
and a molecular weight of 160.85 g/mol. Its IUPAC name is 1,2-dichloropropane;titanium.
Molecular Properties
| Compound Name | 1,2-dichloropropane;titanium |
| PubChem CID | 88762967 |
| Molecular Formula | C3H6Cl2Ti |
| Molecular Weight | 160.85 g/mol |
| Exact Mass | 159.93 |
| IUPAC Name | 1,2-dichloropropane;titanium |
| SMILES | CC(Cl)CCl.[Ti] |
| InChI | InChI=1S/C3H6Cl2.Ti/c1-3(5)2-4;/h3H,2H2,1H3; |
| InChIKey | XRUKFCGPIMGBOD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.85 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloropropane;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloropropane;titanium?
The IUPAC name of 1,2-dichloropropane;titanium (CID 88762967) is 1,2-dichloropropane;titanium.
What is the SMILES notation for 1,2-dichloropropane;titanium?
The canonical SMILES for 1,2-dichloropropane;titanium is CC(Cl)CCl.[Ti].
What is the InChIKey of 1,2-dichloropropane;titanium?
The InChIKey is XRUKFCGPIMGBOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6Cl2.Ti/c1-3(5)2-4;/h3H,2H2,1H3;.
What are the key properties of 1,2-dichloropropane;titanium?
1,2-dichloropropane;titanium has a molecular weight of 160.85 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloropropane;titanium is sourced from PubChem (CID 88762967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).