C7H15Cl2I — CID 88842909
1,2-dichloropropane;1-iodo-2-methylpropane (PubChem CID 88842909) has the molecular formula C7H15Cl2I and a molecular weight of 297.01 g/mol. Its IUPAC name is 1,2-dichloropropane;1-iodo-2-methylpropane.
| Compound Name | 1,2-dichloropropane;1-iodo-2-methylpropane |
|---|---|
| PubChem CID | 88842909 |
| Molecular Formula | C7H15Cl2I |
| Molecular Weight | 297.01 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | 1,2-dichloropropane;1-iodo-2-methylpropane |
| SMILES | CC(C)CI.CC(Cl)CCl |
| InChI | InChI=1S/C4H9I.C3H6Cl2/c1-4(2)3-5;1-3(5)2-4/h4H,3H2,1-2H3;3H,2H2,1H3 |
| InChIKey | UTHFHSUSYFTXRQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.01 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|