About 1-iodo-2-methylpropane;hydrofluoride
1-iodo-2-methylpropane;hydrofluoride (PubChem CID 174557152) has the molecular formula C4H10FI
and a molecular weight of 204.03 g/mol. Its IUPAC name is 1-iodo-2-methylpropane;hydrofluoride.
Molecular Properties
| Compound Name | 1-iodo-2-methylpropane;hydrofluoride |
| PubChem CID | 174557152 |
| Molecular Formula | C4H10FI |
| Molecular Weight | 204.03 g/mol |
| Exact Mass | 203.98 |
| IUPAC Name | 1-iodo-2-methylpropane;hydrofluoride |
| SMILES | CC(C)CI.F |
| InChI | InChI=1S/C4H9I.FH/c1-4(2)3-5;/h4H,3H2,1-2H3;1H |
| InChIKey | TUFJMENNPYEPMP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.03 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-2-methylpropane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-2-methylpropane;hydrofluoride?
The IUPAC name of 1-iodo-2-methylpropane;hydrofluoride (CID 174557152) is 1-iodo-2-methylpropane;hydrofluoride.
What is the SMILES notation for 1-iodo-2-methylpropane;hydrofluoride?
The canonical SMILES for 1-iodo-2-methylpropane;hydrofluoride is CC(C)CI.F.
What is the InChIKey of 1-iodo-2-methylpropane;hydrofluoride?
The InChIKey is TUFJMENNPYEPMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9I.FH/c1-4(2)3-5;/h4H,3H2,1-2H3;1H.
What are the key properties of 1-iodo-2-methylpropane;hydrofluoride?
1-iodo-2-methylpropane;hydrofluoride has a molecular weight of 204.03 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-2-methylpropane;hydrofluoride is sourced from PubChem (CID 174557152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).