About 1,2-diiodo-4-methylpentane
1,2-diiodo-4-methylpentane (PubChem CID 13082779) has the molecular formula C6H12I2
and a molecular weight of 337.97 g/mol. Its IUPAC name is 1,2-diiodo-4-methylpentane.
Molecular Properties
| Compound Name | 1,2-diiodo-4-methylpentane |
| PubChem CID | 13082779 |
| Molecular Formula | C6H12I2 |
| Molecular Weight | 337.97 g/mol |
| Exact Mass | 337.90 |
| IUPAC Name | 1,2-diiodo-4-methylpentane |
| SMILES | CC(C)CC(I)CI |
| InChI | InChI=1S/C6H12I2/c1-5(2)3-6(8)4-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | LZHYKWNXISUDNA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.97 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diiodo-4-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diiodo-4-methylpentane?
The IUPAC name of 1,2-diiodo-4-methylpentane (CID 13082779) is 1,2-diiodo-4-methylpentane.
What is the SMILES notation for 1,2-diiodo-4-methylpentane?
The canonical SMILES for 1,2-diiodo-4-methylpentane is CC(C)CC(I)CI.
What is the InChIKey of 1,2-diiodo-4-methylpentane?
The InChIKey is LZHYKWNXISUDNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12I2/c1-5(2)3-6(8)4-7/h5-6H,3-4H2,1-2H3.
What are the key properties of 1,2-diiodo-4-methylpentane?
1,2-diiodo-4-methylpentane has a molecular weight of 337.97 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diiodo-4-methylpentane is sourced from PubChem (CID 13082779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).