About 2-iodo-N,4-dimethylpentan-1-amine
2-iodo-N,4-dimethylpentan-1-amine (PubChem CID 155421161) has the molecular formula C7H16IN
and a molecular weight of 241.12 g/mol. Its IUPAC name is 2-iodo-N,4-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 2-iodo-N,4-dimethylpentan-1-amine |
| PubChem CID | 155421161 |
| Molecular Formula | C7H16IN |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 2-iodo-N,4-dimethylpentan-1-amine |
| SMILES | CNCC(I)CC(C)C |
| InChI | InChI=1S/C7H16IN/c1-6(2)4-7(8)5-9-3/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | JZMQXZINVGGQMI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-N,4-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-N,4-dimethylpentan-1-amine?
The IUPAC name of 2-iodo-N,4-dimethylpentan-1-amine (CID 155421161) is 2-iodo-N,4-dimethylpentan-1-amine.
What is the SMILES notation for 2-iodo-N,4-dimethylpentan-1-amine?
The canonical SMILES for 2-iodo-N,4-dimethylpentan-1-amine is CNCC(I)CC(C)C.
What is the InChIKey of 2-iodo-N,4-dimethylpentan-1-amine?
The InChIKey is JZMQXZINVGGQMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16IN/c1-6(2)4-7(8)5-9-3/h6-7,9H,4-5H2,1-3H3.
What are the key properties of 2-iodo-N,4-dimethylpentan-1-amine?
2-iodo-N,4-dimethylpentan-1-amine has a molecular weight of 241.12 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-N,4-dimethylpentan-1-amine is sourced from PubChem (CID 155421161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).