C8H19N — CID 90327710
(2S)-N,2,4-trimethylpentan-1-amine (PubChem CID 90327710) has the molecular formula C8H19N and a molecular weight of 129.25 g/mol. Its IUPAC name is (2S)-N,2,4-trimethylpentan-1-amine.
| Compound Name | (2S)-N,2,4-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 90327710 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | (2S)-N,2,4-trimethylpentan-1-amine |
| SMILES | CNC[C@@H](C)CC(C)C |
| InChI | InChI=1S/C8H19N/c1-7(2)5-8(3)6-9-4/h7-9H,5-6H2,1-4H3/t8-/m0/s1 |
| InChIKey | KVLKFVXLVHDQOG-QMMMGPOBSA-N |
| XLogP | 1.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |