C7H17NO — CID 130481162
N-(2,4-dimethylpentyl)hydroxylamine (PubChem CID 130481162) has the molecular formula C7H17NO and a molecular weight of 131.22 g/mol. Its IUPAC name is N-(2,4-dimethylpentyl)hydroxylamine.
| Compound Name | N-(2,4-dimethylpentyl)hydroxylamine |
|---|---|
| PubChem CID | 130481162 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.13 |
| IUPAC Name | N-(2,4-dimethylpentyl)hydroxylamine |
| SMILES | CC(C)CC(C)CNO |
| InChI | InChI=1S/C7H17NO/c1-6(2)4-7(3)5-8-9/h6-9H,4-5H2,1-3H3 |
| InChIKey | KADUEBUTFSERMI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|