C10H25N — CID 142844862
ethane;N,2,4-trimethylpentan-1-amine (PubChem CID 142844862) has the molecular formula C10H25N and a molecular weight of 159.32 g/mol. Its IUPAC name is ethane;N,2,4-trimethylpentan-1-amine.
| Compound Name | ethane;N,2,4-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 142844862 |
| Molecular Formula | C10H25N |
| Molecular Weight | 159.32 g/mol |
| Exact Mass | 159.20 |
| IUPAC Name | ethane;N,2,4-trimethylpentan-1-amine |
| SMILES | CC.CNCC(C)CC(C)C |
| InChI | InChI=1S/C8H19N.C2H6/c1-7(2)5-8(3)6-9-4;1-2/h7-9H,5-6H2,1-4H3;1-2H3 |
| InChIKey | ZVZMQNYDWNSJLO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |