C6H18N2 — CID 144585140
N,2-dimethylpropan-1-amine;methanamine (PubChem CID 144585140) has the molecular formula C6H18N2 and a molecular weight of 118.22 g/mol. Its IUPAC name is N,2-dimethylpropan-1-amine;methanamine.
| Compound Name | N,2-dimethylpropan-1-amine;methanamine |
|---|---|
| PubChem CID | 144585140 |
| Molecular Formula | C6H18N2 |
| Molecular Weight | 118.22 g/mol |
| Exact Mass | 118.15 |
| IUPAC Name | N,2-dimethylpropan-1-amine;methanamine |
| SMILES | CN.CNCC(C)C |
| InChI | InChI=1S/C5H13N.CH5N/c1-5(2)4-6-3;1-2/h5-6H,4H2,1-3H3;2H2,1H3 |
| InChIKey | KADGXDRFYBRONQ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |