C17H42N2 — CID 167692749
N,2-dimethylpropan-1-amine;2-methylbutane;2-methyl-N-propylpropan-1-amine (PubChem CID 167692749) has the molecular formula C17H42N2 and a molecular weight of 274.54 g/mol. Its IUPAC name is N,2-dimethylpropan-1-amine;2-methylbutane;2-methyl-N-propylpropan-1-amine.
| Compound Name | N,2-dimethylpropan-1-amine;2-methylbutane;2-methyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 167692749 |
| Molecular Formula | C17H42N2 |
| Molecular Weight | 274.54 g/mol |
| Exact Mass | 274.33 |
| IUPAC Name | N,2-dimethylpropan-1-amine;2-methylbutane;2-methyl-N-propylpropan-1-amine |
| SMILES | CCC(C)C.CCCNCC(C)C.CNCC(C)C |
| InChI | InChI=1S/C7H17N.C5H13N.C5H12/c1-4-5-8-6-7(2)3;1-5(2)4-6-3;1-4-5(2)3/h7-8H,4-6H2,1-3H3;5-6H,4H2,1-3H3;5H,4H2,1-3H3 |
| InChIKey | XERVSUPHTSKHTE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|