About 3-methylpentane;N-methyl-N'-propylmethanediamine
3-methylpentane;N-methyl-N'-propylmethanediamine (PubChem CID 91531226) has the molecular formula C11H28N2
and a molecular weight of 188.36 g/mol. Its IUPAC name is 3-methylpentane;N-methyl-N'-propylmethanediamine.
Molecular Properties
| Compound Name | 3-methylpentane;N-methyl-N'-propylmethanediamine |
| PubChem CID | 91531226 |
| Molecular Formula | C11H28N2 |
| Molecular Weight | 188.36 g/mol |
| Exact Mass | 188.23 |
| IUPAC Name | 3-methylpentane;N-methyl-N'-propylmethanediamine |
| SMILES | CCC(C)CC.CCCNCNC |
| InChI | InChI=1S/C6H14.C5H14N2/c1-4-6(3)5-2;1-3-4-7-5-6-2/h6H,4-5H2,1-3H3;6-7H,3-5H2,1-2H3 |
| InChIKey | BQTPFZFQNUKSOU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpentane;N-methyl-N'-propylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentane;N-methyl-N'-propylmethanediamine?
The IUPAC name of 3-methylpentane;N-methyl-N'-propylmethanediamine (CID 91531226) is 3-methylpentane;N-methyl-N'-propylmethanediamine.
What is the SMILES notation for 3-methylpentane;N-methyl-N'-propylmethanediamine?
The canonical SMILES for 3-methylpentane;N-methyl-N'-propylmethanediamine is CCC(C)CC.CCCNCNC.
What is the InChIKey of 3-methylpentane;N-methyl-N'-propylmethanediamine?
The InChIKey is BQTPFZFQNUKSOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C5H14N2/c1-4-6(3)5-2;1-3-4-7-5-6-2/h6H,4-5H2,1-3H3;6-7H,3-5H2,1-2H3.
What are the key properties of 3-methylpentane;N-methyl-N'-propylmethanediamine?
3-methylpentane;N-methyl-N'-propylmethanediamine has a molecular weight of 188.36 g/mol, XLogP of 2.61, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentane;N-methyl-N'-propylmethanediamine is sourced from PubChem (CID 91531226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).