C5H8Cl4 — CID 14572537
1,2,3,4-tetrachloropentane (PubChem CID 14572537) has the molecular formula C5H8Cl4 and a molecular weight of 209.93 g/mol. Its IUPAC name is 1,2,3,4-tetrachloropentane.
| Compound Name | 1,2,3,4-tetrachloropentane |
|---|---|
| PubChem CID | 14572537 |
| Molecular Formula | C5H8Cl4 |
| Molecular Weight | 209.93 g/mol |
| Exact Mass | 207.94 |
| IUPAC Name | 1,2,3,4-tetrachloropentane |
| SMILES | CC(Cl)C(Cl)C(Cl)CCl |
| InChI | InChI=1S/C5H8Cl4/c1-3(7)5(9)4(8)2-6/h3-5H,2H2,1H3 |
| InChIKey | XBXONZFAAZDIKX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.93 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|