C13H20Cl8 — CID 169186703
2,3,5,6,8,9,11,12-octachlorotridecane (PubChem CID 169186703) has the molecular formula C13H20Cl8 and a molecular weight of 459.93 g/mol. Its IUPAC name is 2,3,5,6,8,9,11,12-octachlorotridecane.
| Compound Name | 2,3,5,6,8,9,11,12-octachlorotridecane |
|---|---|
| PubChem CID | 169186703 |
| Molecular Formula | C13H20Cl8 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 455.91 |
| IUPAC Name | 2,3,5,6,8,9,11,12-octachlorotridecane |
| SMILES | CC(Cl)C(Cl)CC(Cl)C(Cl)CC(Cl)C(Cl)CC(Cl)C(C)Cl |
| InChI | InChI=1S/C13H20Cl8/c1-6(14)8(16)3-10(18)12(20)5-13(21)11(19)4-9(17)7(2)15/h6-13H,3-5H2,1-2H3 |
| InChIKey | HDSXKDGFYKSSTM-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|