C6H10Cl4O — CID 87756371
1,1,4,5-tetrachlorohexan-2-ol (PubChem CID 87756371) has the molecular formula C6H10Cl4O and a molecular weight of 239.96 g/mol. Its IUPAC name is 1,1,4,5-tetrachlorohexan-2-ol.
| Compound Name | 1,1,4,5-tetrachlorohexan-2-ol |
|---|---|
| PubChem CID | 87756371 |
| Molecular Formula | C6H10Cl4O |
| Molecular Weight | 239.96 g/mol |
| Exact Mass | 237.95 |
| IUPAC Name | 1,1,4,5-tetrachlorohexan-2-ol |
| SMILES | CC(Cl)C(Cl)CC(O)C(Cl)Cl |
| InChI | InChI=1S/C6H10Cl4O/c1-3(7)4(8)2-5(11)6(9)10/h3-6,11H,2H2,1H3 |
| InChIKey | XMXFWMLKCHDFMM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.96 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|