About 1,1-dichlorohexan-2-ol
1,1-dichlorohexan-2-ol (PubChem CID 11019309) has the molecular formula C6H12Cl2O
and a molecular weight of 171.07 g/mol. Its IUPAC name is 1,1-dichlorohexan-2-ol.
Molecular Properties
| Compound Name | 1,1-dichlorohexan-2-ol |
| PubChem CID | 11019309 |
| Molecular Formula | C6H12Cl2O |
| Molecular Weight | 171.07 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 1,1-dichlorohexan-2-ol |
| SMILES | CCCCC(O)C(Cl)Cl |
| InChI | InChI=1S/C6H12Cl2O/c1-2-3-4-5(9)6(7)8/h5-6,9H,2-4H2,1H3 |
| InChIKey | PWBWGSKUCAAMTO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.07 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichlorohexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichlorohexan-2-ol?
The IUPAC name of 1,1-dichlorohexan-2-ol (CID 11019309) is 1,1-dichlorohexan-2-ol.
What is the SMILES notation for 1,1-dichlorohexan-2-ol?
The canonical SMILES for 1,1-dichlorohexan-2-ol is CCCCC(O)C(Cl)Cl.
What is the InChIKey of 1,1-dichlorohexan-2-ol?
The InChIKey is PWBWGSKUCAAMTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12Cl2O/c1-2-3-4-5(9)6(7)8/h5-6,9H,2-4H2,1H3.
What are the key properties of 1,1-dichlorohexan-2-ol?
1,1-dichlorohexan-2-ol has a molecular weight of 171.07 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichlorohexan-2-ol is sourced from PubChem (CID 11019309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).