C7H15ClO2 — CID 102376959
(2R,3R)-1-chloroheptane-2,3-diol (PubChem CID 102376959) has the molecular formula C7H15ClO2 and a molecular weight of 166.65 g/mol. Its IUPAC name is (2R,3R)-1-chloroheptane-2,3-diol.
| Compound Name | (2R,3R)-1-chloroheptane-2,3-diol |
|---|---|
| PubChem CID | 102376959 |
| Molecular Formula | C7H15ClO2 |
| Molecular Weight | 166.65 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (2R,3R)-1-chloroheptane-2,3-diol |
| SMILES | CCCC[C@@H](O)[C@@H](O)CCl |
| InChI | InChI=1S/C7H15ClO2/c1-2-3-4-6(9)7(10)5-8/h6-7,9-10H,2-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | RPONQQLIMKPRDX-RQJHMYQMSA-N |
| XLogP | 1.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.65 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|