C12H22Cl6O4 — CID 139115848
(2S,3R,4S,5R)-3,4,5-trichlorohexane-1,2-diol (PubChem CID 139115848) has the molecular formula C12H22Cl6O4 and a molecular weight of 443.02 g/mol. Its IUPAC name is (2S,3R,4S,5R)-3,4,5-trichlorohexane-1,2-diol.
| Compound Name | (2S,3R,4S,5R)-3,4,5-trichlorohexane-1,2-diol |
|---|---|
| PubChem CID | 139115848 |
| Molecular Formula | C12H22Cl6O4 |
| Molecular Weight | 443.02 g/mol |
| Exact Mass | 439.96 |
| IUPAC Name | (2S,3R,4S,5R)-3,4,5-trichlorohexane-1,2-diol |
| SMILES | C[C@@H](Cl)[C@H](Cl)[C@H](Cl)[C@@H](O)CO.C[C@@H](Cl)[C@H](Cl)[C@H](Cl)[C@@H](O)CO |
| InChI | InChI=1S/2C6H11Cl3O2/c2*1-3(7)5(8)6(9)4(11)2-10/h2*3-6,10-11H,2H2,1H3/t2*3-,4+,5+,6-/m11/s1 |
| InChIKey | PODLQDLZGZHXFL-PIIYHDNRSA-N |
| XLogP | 2.36 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.02 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|