C6H10Cl4O2 — CID 87115034
2,3,4,6-tetrachlorohexane-1,5-diol (PubChem CID 87115034) has the molecular formula C6H10Cl4O2 and a molecular weight of 255.96 g/mol. Its IUPAC name is 2,3,4,6-tetrachlorohexane-1,5-diol.
| Compound Name | 2,3,4,6-tetrachlorohexane-1,5-diol |
|---|---|
| PubChem CID | 87115034 |
| Molecular Formula | C6H10Cl4O2 |
| Molecular Weight | 255.96 g/mol |
| Exact Mass | 253.94 |
| IUPAC Name | 2,3,4,6-tetrachlorohexane-1,5-diol |
| SMILES | OCC(Cl)C(Cl)C(Cl)C(O)CCl |
| InChI | InChI=1S/C6H10Cl4O2/c7-1-4(12)6(10)5(9)3(8)2-11/h3-6,11-12H,1-2H2 |
| InChIKey | UXUUMJPFOIYUBC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.96 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|