About alumane;1,2-dichloroethanol
alumane;1,2-dichloroethanol (PubChem CID 174606739) has the molecular formula C2H7AlCl2O
and a molecular weight of 144.97 g/mol. Its IUPAC name is alumane;1,2-dichloroethanol.
Molecular Properties
| Compound Name | alumane;1,2-dichloroethanol |
| PubChem CID | 174606739 |
| Molecular Formula | C2H7AlCl2O |
| Molecular Weight | 144.97 g/mol |
| Exact Mass | 143.97 |
| IUPAC Name | alumane;1,2-dichloroethanol |
| SMILES | OC(Cl)CCl.[AlH3] |
| InChI | InChI=1S/C2H4Cl2O.Al.3H/c3-1-2(4)5;;;;/h2,5H,1H2;;;; |
| InChIKey | RTJFDGMUZZIWJQ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.97 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze alumane;1,2-dichloroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;1,2-dichloroethanol?
The IUPAC name of alumane;1,2-dichloroethanol (CID 174606739) is alumane;1,2-dichloroethanol.
What is the SMILES notation for alumane;1,2-dichloroethanol?
The canonical SMILES for alumane;1,2-dichloroethanol is OC(Cl)CCl.[AlH3].
What is the InChIKey of alumane;1,2-dichloroethanol?
The InChIKey is RTJFDGMUZZIWJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4Cl2O.Al.3H/c3-1-2(4)5;;;;/h2,5H,1H2;;;;.
What are the key properties of alumane;1,2-dichloroethanol?
alumane;1,2-dichloroethanol has a molecular weight of 144.97 g/mol, XLogP of -0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;1,2-dichloroethanol is sourced from PubChem (CID 174606739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).