C4H7Cl3O — CID 140995909
1,4,4-trichlorobutan-1-ol (PubChem CID 140995909) has the molecular formula C4H7Cl3O and a molecular weight of 177.46 g/mol. Its IUPAC name is 1,4,4-trichlorobutan-1-ol.
| Compound Name | 1,4,4-trichlorobutan-1-ol |
|---|---|
| PubChem CID | 140995909 |
| Molecular Formula | C4H7Cl3O |
| Molecular Weight | 177.46 g/mol |
| Exact Mass | 175.96 |
| IUPAC Name | 1,4,4-trichlorobutan-1-ol |
| SMILES | OC(Cl)CCC(Cl)Cl |
| InChI | InChI=1S/C4H7Cl3O/c5-3(6)1-2-4(7)8/h3-4,8H,1-2H2 |
| InChIKey | VROHONKPYKWPRT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|