C7H16ClNO2 — CID 129013782
1-chloro-4-(dimethylamino)pentane-1,5-diol (PubChem CID 129013782) has the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. Its IUPAC name is 1-chloro-4-(dimethylamino)pentane-1,5-diol.
| Compound Name | 1-chloro-4-(dimethylamino)pentane-1,5-diol |
|---|---|
| PubChem CID | 129013782 |
| Molecular Formula | C7H16ClNO2 |
| Molecular Weight | 181.66 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 1-chloro-4-(dimethylamino)pentane-1,5-diol |
| SMILES | CN(C)C(CO)CCC(O)Cl |
| InChI | InChI=1S/C7H16ClNO2/c1-9(2)6(5-10)3-4-7(8)11/h6-7,10-11H,3-5H2,1-2H3 |
| InChIKey | BQJFMACDBXDCDK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.66 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|