C5H10Cl2O2 — CID 57079460
1,5-dichloropentane-1,5-diol (PubChem CID 57079460) has the molecular formula C5H10Cl2O2 and a molecular weight of 173.04 g/mol. Its IUPAC name is 1,5-dichloropentane-1,5-diol.
| Compound Name | 1,5-dichloropentane-1,5-diol |
|---|---|
| PubChem CID | 57079460 |
| Molecular Formula | C5H10Cl2O2 |
| Molecular Weight | 173.04 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 1,5-dichloropentane-1,5-diol |
| SMILES | OC(Cl)CCCC(O)Cl |
| InChI | InChI=1S/C5H10Cl2O2/c6-4(8)2-1-3-5(7)9/h4-5,8-9H,1-3H2 |
| InChIKey | BDOTYTOLPSIRJQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.04 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|