C21H43ClO4 — CID 175542698
1-chloropropane-1,3-diol;octadecanoic acid (PubChem CID 175542698) has the molecular formula C21H43ClO4 and a molecular weight of 395.02 g/mol. Its IUPAC name is 1-chloropropane-1,3-diol;octadecanoic acid.
| Compound Name | 1-chloropropane-1,3-diol;octadecanoic acid |
|---|---|
| PubChem CID | 175542698 |
| Molecular Formula | C21H43ClO4 |
| Molecular Weight | 395.02 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | 1-chloropropane-1,3-diol;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.OCCC(O)Cl |
| InChI | InChI=1S/C18H36O2.C3H7ClO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;4-3(6)1-2-5/h2-17H2,1H3,(H,19,20);3,5-6H,1-2H2 |
| InChIKey | XDDLATSZQUHVQO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.02 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|