About (3,3-Dichloropropyl)silane
(3,3-Dichloropropyl)silane (PubChem CID 57000949) has the molecular formula C3H5Cl2Si
and a molecular weight of 140.06 g/mol.
Molecular Properties
| Compound Name | (3,3-Dichloropropyl)silane |
| PubChem CID | 57000949 |
| Molecular Formula | C3H5Cl2Si |
| Molecular Weight | 140.06 g/mol |
| Exact Mass | 138.95 |
| IUPAC Name | — |
| SMILES | [Si]CCC(Cl)Cl |
| InChI | InChI=1S/C3H5Cl2Si/c4-3(5)1-2-6/h3H,1-2H2 |
| InChIKey | UHOVGQOCQAKJFI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.06 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3,3-Dichloropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-Dichloropropyl)silane?
The IUPAC name of (3,3-Dichloropropyl)silane (CID 57000949) is not available.
What is the SMILES notation for (3,3-Dichloropropyl)silane?
The canonical SMILES for (3,3-Dichloropropyl)silane is [Si]CCC(Cl)Cl.
What is the InChIKey of (3,3-Dichloropropyl)silane?
The InChIKey is UHOVGQOCQAKJFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5Cl2Si/c4-3(5)1-2-6/h3H,1-2H2.
What are the key properties of (3,3-Dichloropropyl)silane?
(3,3-Dichloropropyl)silane has a molecular weight of 140.06 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-Dichloropropyl)silane is sourced from PubChem (CID 57000949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).